Difference between revisions of "3-HYDROXY-PROPIONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Uracil-54-in-tRNA == * common-name: ** a uracil54 in trna == Reaction(s) known to consume the compound == * 2.1.1.74-RXN == Reaction(...")
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-PROPIONYL-COA == * common-name: ** 3-hydroxypropanoyl-coa * molecular-weight: ** 835.566 * inchi-key: ** berbfzcusmqabm-iexphml...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Uracil-54-in-tRNA ==
+
== Metabolite 3-HYDROXY-PROPIONYL-COA ==
 
* common-name:
 
* common-name:
** a uracil54 in trna
+
** 3-hydroxypropanoyl-coa
 +
* molecular-weight:
 +
** 835.566
 +
* inchi-key:
 +
** berbfzcusmqabm-iexphmlfsa-j
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.74-RXN]]
+
* [[RXN-6383]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-6383]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a uracil54 in trna}}
+
{{#set: common-name=3-hydroxypropanoyl-coa}}
 +
{{#set: molecular-weight=835.566}}
 +
{{#set: inchi-key=inchikey=berbfzcusmqabm-iexphmlfsa-j}}

Latest revision as of 19:33, 17 March 2021

Metabolite 3-HYDROXY-PROPIONYL-COA

  • common-name:
    • 3-hydroxypropanoyl-coa
  • molecular-weight:
    • 835.566
  • inchi-key:
    • berbfzcusmqabm-iexphmlfsa-j
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality