Difference between revisions of "CPD-8999"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17283 == * common-name: ** a [glycerolipid]-di-homo-γ-linolenate == Reaction(s) known to consume the compound == == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-8999 == * common-name: ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate * molecular-weight: ** 240.167 * inchi-key: ** hkeaovfnwrdva...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-8999 == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate |
+ | * molecular-weight: | ||
+ | ** 240.167 | ||
+ | * inchi-key: | ||
+ | ** hkeaovfnwrdvaj-uhfffaoysa-l | ||
+ | * smiles: | ||
+ | ** csccc(=o)c(=o)cop([o-])(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[3.1.3.77-RXN]] | ||
+ | * [[R82-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[R145-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate}} |
+ | {{#set: molecular-weight=240.167}} | ||
+ | {{#set: inchi-key=inchikey=hkeaovfnwrdvaj-uhfffaoysa-l}} |
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite CPD-8999
- common-name:
- 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate
- molecular-weight:
- 240.167
- inchi-key:
- hkeaovfnwrdvaj-uhfffaoysa-l
- smiles:
- csccc(=o)c(=o)cop([o-])(=o)[o-]