Difference between revisions of "Histone-L-arginines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6991 == * common-name: ** (2s)-pinocembrin * molecular-weight: ** 255.249 * inchi-key: ** urfcjeuyxnahfi-zdusscgksa-m * smiles: ** c3...")
(Created page with "Category:metabolite == Metabolite Histone-L-arginines == * common_name: ** [histone]-l-arginine == Reaction(s) known to consume the compound == * 2.1.1.125-RXN == Reac...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6991 ==
+
== Metabolite Histone-L-arginines ==
* common-name:
+
* common_name:
** (2s)-pinocembrin
+
** [histone]-l-arginine
* molecular-weight:
 
** 255.249
 
* inchi-key:
 
** urfcjeuyxnahfi-zdusscgksa-m
 
* smiles:
 
** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7648]]
+
* [[2.1.1.125-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7647]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s)-pinocembrin}}
+
{{#set: common_name=[histone]-l-arginine}}
{{#set: molecular-weight=255.249}}
 
{{#set: inchi-key=inchikey=urfcjeuyxnahfi-zdusscgksa-m}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite Histone-L-arginines

  • common_name:
    • [histone]-l-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common name" (as page type) with input value "histone]-l-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.