Difference between revisions of "L-ASPARTATE"

Latest revision as of 19:33, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-10332 ==
+== Metabolite L-ASPARTATE ==
 * common-name:
-** gibberellin44 (open lactone form)
+** l-aspartate
 * molecular-weight:
-** 362.422
+** 132.096
 * inchi-key:
-** axeuuxhmkspqai-ytjhipewsa-l
+** ckljmwtzizzhcs-reohclbhsa-m
 * smiles:
-** c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(co)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
+** c(c(=o)[o-])c([n+])c(=o)[o-]
 == Reaction(s) known to consume the compound ==
-* [[RXN1F-168]]
+* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+* [[ARGSUCCINSYN-RXN]]
+* [[ASNSYNA-RXN]]
+* [[ASNSYNB-RXN]]
+* [[ASPAMINOTRANS-RXN]]
+* [[ASPARTATE--TRNA-LIGASE-RXN]]
+* [[ASPARTATEKIN-RXN]]
+* [[ASPCARBTRANS-RXN]]
+* [[L-ASPARTATE-OXID-RXN]]
+* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
+* [[RXN-10]]
+* [[RXN-13697]]
+* [[SAICARSYN-RXN]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[RXN1F-167]]
+* [[3.5.1.26-RXN]]
+* [[ASPAMINOTRANS-RXN]]
+* [[ASPARAGHYD-RXN]]
+* [[ASPCARBTRANS-RXN]]
+* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
+* [[RXN-13697]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=gibberellin44 (open lactone form)}}
+{{#set: common-name=l-aspartate}}
-{{#set: molecular-weight=362.422}}
+{{#set: molecular-weight=132.096}}
-{{#set: inchi-key=inchikey=axeuuxhmkspqai-ytjhipewsa-l}}
+{{#set: inchi-key=inchikey=ckljmwtzizzhcs-reohclbhsa-m}}