Difference between revisions of "L-DEHYDRO-ASCORBATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-510 == * common-name: ** α-d-glucuronate 1-phosphate * molecular-weight: ** 271.097 * inchi-key: ** aiqdykmwenwvqj-qiuujyrfsa-k...") |
(Created page with "Category:metabolite == Metabolite L-DEHYDRO-ASCORBATE == * common-name: ** l-dehydro-ascorbate * molecular-weight: ** 174.11 * inchi-key: ** sbjkkffyizucet-szscbosdsa-n *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-DEHYDRO-ASCORBATE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-dehydro-ascorbate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 174.11 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sbjkkffyizucet-szscbosdsa-n |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.8.5.1-RXN]] |
+ | * [[RXN-12862]] | ||
+ | * [[RXN-12869]] | ||
+ | * [[RXN-13185]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12440]] |
+ | * [[RXN-12876]] | ||
+ | * [[RXN-13185]] | ||
+ | * [[RXN-3523]] | ||
+ | * [[RXN-7984]] | ||
+ | * [[RXN-7985]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-dehydro-ascorbate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=174.11}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sbjkkffyizucet-szscbosdsa-n}} |
Latest revision as of 19:33, 17 March 2021
Contents
Metabolite L-DEHYDRO-ASCORBATE
- common-name:
- l-dehydro-ascorbate
- molecular-weight:
- 174.11
- inchi-key:
- sbjkkffyizucet-szscbosdsa-n
- smiles:
- c(o)c(o)c1(c(=o)c(=o)c(=o)o1)