Difference between revisions of "CPD-11520"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1242 == * common-name: ** 3-keto-β-d-galactose * molecular-weight: ** 178.141 * inchi-key: ** apiqnbnbiiccon-fkmsrsahsa-n * smil...")
(Created page with "Category:metabolite == Metabolite CPD-11520 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa * molecular-weight: ** 1053.904 * inchi-key:...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-1242 ==
+
== Metabolite CPD-11520 ==
 
* common-name:
 
* common-name:
** 3-keto-β-d-galactose
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa
 
* molecular-weight:
 
* molecular-weight:
** 178.141
+
** 1053.904
 
* inchi-key:
 
* inchi-key:
** apiqnbnbiiccon-fkmsrsahsa-n
+
** yyccmactoajggw-ozvhgmpnsa-j
 
* smiles:
 
* smiles:
** c(o)c1(oc(c(c(c1o)=o)o)o)
+
** ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10699]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[KETOLACTOSE-RXN]]
+
* [[RXN-10698]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-keto-β-d-galactose}}
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa}}
{{#set: molecular-weight=178.141}}
+
{{#set: molecular-weight=1053.904}}
{{#set: inchi-key=inchikey=apiqnbnbiiccon-fkmsrsahsa-n}}
+
{{#set: inchi-key=inchikey=yyccmactoajggw-ozvhgmpnsa-j}}

Latest revision as of 19:34, 17 March 2021

Metabolite CPD-11520

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3-oxooctanoyl)-coa
  • molecular-weight:
    • 1053.904
  • inchi-key:
    • yyccmactoajggw-ozvhgmpnsa-j
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccccc(=o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality