Difference between revisions of "CPD-18077"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLUTATHIONE == * common-name: ** glutathione * molecular-weight: ** 306.313 * inchi-key: ** rwsxrvcmgqzwbv-wdskdsinsa-m * smiles: ** c(s)...")
(Created page with "Category:metabolite == Metabolite CPD-18077 == * common-name: ** glc3man9glcnac2-[protein] == Reaction(s) known to consume the compound == * 3.2.1.106-RXN == Reaction(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLUTATHIONE ==
+
== Metabolite CPD-18077 ==
 
* common-name:
 
* common-name:
** glutathione
+
** glc3man9glcnac2-[protein]
* molecular-weight:
 
** 306.313
 
* inchi-key:
 
** rwsxrvcmgqzwbv-wdskdsinsa-m
 
* smiles:
 
** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.11.1.12-RXN]]
+
* [[3.2.1.106-RXN]]
* [[1.8.5.1-RXN]]
 
* [[2.3.2.15-RXN]]
 
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 
* [[GLYOXI-RXN]]
 
* [[GSHTRAN-RXN]]
 
* [[GST-RXN]]
 
* [[PRODISULFREDUCT-A-RXN]]
 
* [[RXN-13673]]
 
* [[RXN-15680]]
 
* [[RXN-6601]]
 
* [[RXN-9157]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
+
* [[2.4.1.119-RXN]]
* [[GLUTATHIONE-SYN-RXN]]
 
* [[GLYOXI-RXN]]
 
* [[GLYOXII-RXN]]
 
* [[RXN-13161]]
 
* [[RXN-15348]]
 
* [[RXN-16574]]
 
* [[RXN-2961]]
 
* [[RXN-7919]]
 
* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glutathione}}
+
{{#set: common-name=glc3man9glcnac2-[protein]}}
{{#set: molecular-weight=306.313}}
 
{{#set: inchi-key=inchikey=rwsxrvcmgqzwbv-wdskdsinsa-m}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite CPD-18077

  • common-name:
    • glc3man9glcnac2-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "glc3man9glcnac2-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.