Difference between revisions of "CPD-18085"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HSCN == * common-name: ** thiocyanate * molecular-weight: ** 58.078 * inchi-key: ** zmzdmbwjuhkjps-uhfffaoysa-m * smiles: ** c(#n)[s-] ==...") |
(Created page with "Category:metabolite == Metabolite CPD-18085 == * common-name: ** 1,2-dihydro-β-nadp * molecular-weight: ** 741.394 * inchi-key: ** snzsfaqyvlpebz-nnyoxohssa-j * smile...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-18085 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1,2-dihydro-β-nadp |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 741.394 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** snzsfaqyvlpebz-nnyoxohssa-j |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))cc(=cc=5)c(=o)n) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16765]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1,2-dihydro-β-nadp}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=741.394}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=snzsfaqyvlpebz-nnyoxohssa-j}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite CPD-18085
- common-name:
- 1,2-dihydro-β-nadp
- molecular-weight:
- 741.394
- inchi-key:
- snzsfaqyvlpebz-nnyoxohssa-j
- smiles:
- c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))cc(=cc=5)c(=o)n)
