Difference between revisions of "DADP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEAMIDO-NAD == * common-name: ** nicotinate adenine dinucleotide * molecular-weight: ** 662.399 * inchi-key: ** senpvezbrzqvst-hisdbwnosa...") |
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * molecular-weight: ** 408.18 * inchi-key: ** daeapnuqqaicnr-rrkcrqdmsa-k * smiles: ** c(c3(c(cc(n2(c1(=c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DADP == |
* common-name: | * common-name: | ||
− | ** | + | ** dadp |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 408.18 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** daeapnuqqaicnr-rrkcrqdmsa-k |
* smiles: | * smiles: | ||
− | ** | + | ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DADPKIN-RXN]] |
− | * [[ | + | * [[RXN-14192]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ADPREDUCT-RXN]] |
+ | * [[DEOXYADENYLATE-KINASE-RXN]] | ||
+ | * [[RXN0-747]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dadp}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=408.18}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite DADP
- common-name:
- dadp
- molecular-weight:
- 408.18
- inchi-key:
- daeapnuqqaicnr-rrkcrqdmsa-k
- smiles:
- c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o