Difference between revisions of "DADP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEAMIDO-NAD == * common-name: ** nicotinate adenine dinucleotide * molecular-weight: ** 662.399 * inchi-key: ** senpvezbrzqvst-hisdbwnosa...")
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * molecular-weight: ** 408.18 * inchi-key: ** daeapnuqqaicnr-rrkcrqdmsa-k * smiles: ** c(c3(c(cc(n2(c1(=c(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DEAMIDO-NAD ==
+
== Metabolite DADP ==
 
* common-name:
 
* common-name:
** nicotinate adenine dinucleotide
+
** dadp
 
* molecular-weight:
 
* molecular-weight:
** 662.399
+
** 408.18
 
* inchi-key:
 
* inchi-key:
** senpvezbrzqvst-hisdbwnosa-l
+
** daeapnuqqaicnr-rrkcrqdmsa-k
 
* smiles:
 
* smiles:
** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
+
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NAD-SYNTH-GLN-RXN]]
+
* [[DADPKIN-RXN]]
* [[NAD-SYNTH-NH3-RXN]]
+
* [[RXN-14192]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NICONUCADENYLYLTRAN-RXN]]
+
* [[ADPREDUCT-RXN]]
 +
* [[DEOXYADENYLATE-KINASE-RXN]]
 +
* [[RXN0-747]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nicotinate adenine dinucleotide}}
+
{{#set: common-name=dadp}}
{{#set: molecular-weight=662.399}}
+
{{#set: molecular-weight=408.18}}
{{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}}
+
{{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}}

Latest revision as of 19:34, 17 March 2021

Metabolite DADP

  • common-name:
    • dadp
  • molecular-weight:
    • 408.18
  • inchi-key:
    • daeapnuqqaicnr-rrkcrqdmsa-k
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality