Difference between revisions of "DEAMIDO-NAD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1107 == * common-name: ** d-myo-inositol 1,3,4,5,6-pentakisphosphate * molecular-weight: ** 569.977 * inchi-key: ** ctpqaxvnygzuaj-kx...")
(Created page with "Category:metabolite == Metabolite DEAMIDO-NAD == * common-name: ** nicotinate adenine dinucleotide * molecular-weight: ** 662.399 * inchi-key: ** senpvezbrzqvst-hisdbwnosa...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-1107 ==
+
== Metabolite DEAMIDO-NAD ==
 
* common-name:
 
* common-name:
** d-myo-inositol 1,3,4,5,6-pentakisphosphate
+
** nicotinate adenine dinucleotide
 
* molecular-weight:
 
* molecular-weight:
** 569.977
+
** 662.399
 
* inchi-key:
 
* inchi-key:
** ctpqaxvnygzuaj-kxxvrosksa-d
+
** senpvezbrzqvst-hisdbwnosa-l
 
* smiles:
 
* smiles:
** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10955]]
+
* [[NAD-SYNTH-GLN-RXN]]
* [[RXN-4941]]
+
* [[NAD-SYNTH-NH3-RXN]]
* [[RXN-7163]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.134-RXN]]
+
* [[NICONUCADENYLYLTRAN-RXN]]
* [[2.7.1.140-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol 1,3,4,5,6-pentakisphosphate}}
+
{{#set: common-name=nicotinate adenine dinucleotide}}
{{#set: molecular-weight=569.977}}
+
{{#set: molecular-weight=662.399}}
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-kxxvrosksa-d}}
+
{{#set: inchi-key=inchikey=senpvezbrzqvst-hisdbwnosa-l}}

Latest revision as of 19:34, 17 March 2021

Metabolite DEAMIDO-NAD

  • common-name:
    • nicotinate adenine dinucleotide
  • molecular-weight:
    • 662.399
  • inchi-key:
    • senpvezbrzqvst-hisdbwnosa-l
  • smiles:
    • c1(c(=cc=c[n+]=1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c([o-])=o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality