Difference between revisions of "D-GLUCOSAMINE-6-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15675 == * common-name: ** 2-trans-6-trans-tridecadienoyl-coa * molecular-weight: ** 955.803 * inchi-key: ** oosdlbaxvxkfib-bjbrngjvs...")
(Created page with "Category:metabolite == Metabolite D-GLUCOSAMINE-6-P == * common-name: ** d-glucosamine 6-phosphate == Reaction(s) known to consume the compound == * GLUCOSAMINEPNACETYLT...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15675 ==
+
== Metabolite D-GLUCOSAMINE-6-P ==
 
* common-name:
 
* common-name:
** 2-trans-6-trans-tridecadienoyl-coa
+
** d-glucosamine 6-phosphate
* molecular-weight:
 
** 955.803
 
* inchi-key:
 
** oosdlbaxvxkfib-bjbrngjvsa-j
 
* smiles:
 
** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLUCOSAMINEPNACETYLTRANS-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14785]]
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans-6-trans-tridecadienoyl-coa}}
+
{{#set: common-name=d-glucosamine 6-phosphate}}
{{#set: molecular-weight=955.803}}
 
{{#set: inchi-key=inchikey=oosdlbaxvxkfib-bjbrngjvsa-j}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite D-GLUCOSAMINE-6-P

  • common-name:
    • d-glucosamine 6-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality