Difference between revisions of "CPD-10267"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-METHYL-CROTONYL-COA == * common-name: ** 3-methylcrotonyl-coa * molecular-weight: ** 845.604 * inchi-key: ** bxipalatiynhjn-zmhdxicwsa-...") |
(Created page with "Category:metabolite == Metabolite CPD-10267 == * common-name: ** decanoyl-coa * molecular-weight: ** 917.754 * inchi-key: ** cnkjphsefdpydb-hsjnekgzsa-j * smiles: ** ccccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-10267 == |
* common-name: | * common-name: | ||
| − | ** | + | ** decanoyl-coa |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 917.754 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cnkjphsefdpydb-hsjnekgzsa-j |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-13615]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-13614]] |
| − | * [[RXN- | + | * [[RXN-14274]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=decanoyl-coa}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=917.754}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cnkjphsefdpydb-hsjnekgzsa-j}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite CPD-10267
- common-name:
- decanoyl-coa
- molecular-weight:
- 917.754
- inchi-key:
- cnkjphsefdpydb-hsjnekgzsa-j
- smiles:
- cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
