Difference between revisions of "DEOXYADENOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8120 == * common_name: ** di-homo-γ-linolenate * smiles: ** cccccc=ccc=ccc=cccccccc(=o)[o-] * inchi_key: ** inchikey=hobaelrkjc...") |
(Created page with "Category:metabolite == Metabolite DEOXYADENOSINE == * common-name: ** 2'-deoxyadenosine * molecular-weight: ** 251.244 * inchi-key: ** olxzpdwkrnyjjz-rrkcrqdmsa-n * smiles...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DEOXYADENOSINE == |
| − | * | + | * common-name: |
| − | ** | + | ** 2'-deoxyadenosine |
| + | * molecular-weight: | ||
| + | ** 251.244 | ||
| + | * inchi-key: | ||
| + | ** olxzpdwkrnyjjz-rrkcrqdmsa-n | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23))) |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ADDALT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=2'-deoxyadenosine}} |
| − | {{#set: | + | {{#set: molecular-weight=251.244}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=olxzpdwkrnyjjz-rrkcrqdmsa-n}} |
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite DEOXYADENOSINE
- common-name:
- 2'-deoxyadenosine
- molecular-weight:
- 251.244
- inchi-key:
- olxzpdwkrnyjjz-rrkcrqdmsa-n
- smiles:
- c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23)))
