Difference between revisions of "CPD-469"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-ALPHA-ACETYLORNITHINE == * common-name: ** n-acetyl-l-ornithine * molecular-weight: ** 174.199 * inchi-key: ** jrlgpaxaghmnol-lurjtmies...")
(Created page with "Category:metabolite == Metabolite CPD-469 == * common-name: ** n-acetyl-l-glutamate 5-semialdehyde * molecular-weight: ** 172.16 * inchi-key: ** bcpsfkbphhbdai-lurjtmiesa-...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-ALPHA-ACETYLORNITHINE ==
+
== Metabolite CPD-469 ==
 
* common-name:
 
* common-name:
** n-acetyl-l-ornithine
+
** n-acetyl-l-glutamate 5-semialdehyde
 
* molecular-weight:
 
* molecular-weight:
** 174.199
+
** 172.16
 
* inchi-key:
 
* inchi-key:
** jrlgpaxaghmnol-lurjtmiesa-n
+
** bcpsfkbphhbdai-lurjtmiesa-m
 
* smiles:
 
* smiles:
** cc(=o)nc(ccc[n+])c(=o)[o-]
+
** cc(=o)nc(c([o-])=o)cc[ch]=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLORNDEACET-RXN]]
 
 
* [[ACETYLORNTRANSAM-RXN]]
 
* [[ACETYLORNTRANSAM-RXN]]
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
+
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLORNDEACET-RXN]]
 
 
* [[ACETYLORNTRANSAM-RXN]]
 
* [[ACETYLORNTRANSAM-RXN]]
 +
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-l-ornithine}}
+
{{#set: common-name=n-acetyl-l-glutamate 5-semialdehyde}}
{{#set: molecular-weight=174.199}}
+
{{#set: molecular-weight=172.16}}
{{#set: inchi-key=inchikey=jrlgpaxaghmnol-lurjtmiesa-n}}
+
{{#set: inchi-key=inchikey=bcpsfkbphhbdai-lurjtmiesa-m}}

Latest revision as of 19:35, 17 March 2021

Metabolite CPD-469

  • common-name:
    • n-acetyl-l-glutamate 5-semialdehyde
  • molecular-weight:
    • 172.16
  • inchi-key:
    • bcpsfkbphhbdai-lurjtmiesa-m
  • smiles:
    • cc(=o)nc(c([o-])=o)cc[ch]=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality