Difference between revisions of "DEHYDROQUINATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite FORMATE == * common-name: ** formate * molecular-weight: ** 45.018 * inchi-key: ** bdagihxwwsansr-uhfffaoysa-m * smiles: ** [ch]([o-])=o...") |
(Created page with "Category:metabolite == Metabolite DEHYDROQUINATE == * common-name: ** 3-dehydroquinate * molecular-weight: ** 189.144 * inchi-key: ** wvmwzwgzraxubk-sytvjdicsa-m * smiles:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DEHYDROQUINATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-dehydroquinate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 189.144 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wvmwzwgzraxubk-sytvjdicsa-m |
* smiles: | * smiles: | ||
− | ** | + | ** c(=o)([o-])c1(o)(cc(=o)c(o)c(o)c1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] | |
− | * [[3 | + | * [[3-DEHYDROQUINATE-SYNTHASE-RXN]] |
− | + | * [[QUINATE-5-DEHYDROGENASE-RXN]] | |
− | + | * [[RXN-7967]] | |
− | * [[ | ||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-dehydroquinate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=189.144}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wvmwzwgzraxubk-sytvjdicsa-m}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite DEHYDROQUINATE
- common-name:
- 3-dehydroquinate
- molecular-weight:
- 189.144
- inchi-key:
- wvmwzwgzraxubk-sytvjdicsa-m
- smiles:
- c(=o)([o-])c1(o)(cc(=o)c(o)c(o)c1)