Difference between revisions of "DEHYDROQUINATE"

Latest revision as of 19:35, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite FORMATE ==
+== Metabolite DEHYDROQUINATE ==
 * common-name:
-** formate
+** 3-dehydroquinate
 * molecular-weight:
-** 45.018
+** 189.144
 * inchi-key:
-** bdagihxwwsansr-uhfffaoysa-m
+** wvmwzwgzraxubk-sytvjdicsa-m
 * smiles:
-** [ch]([o-])=o
+** c(=o)([o-])c1(o)(cc(=o)c(o)c(o)c1)
 == Reaction(s) known to consume the compound ==
-* [[1.2.1.2-RXN]]
+* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
-* [[FORMATETHFLIG-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[1.2.1.2-RXN]]
+* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
-* [[3.5.1.27-RXN]]
+* [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
-* [[3.5.1.88-RXN]]
+* [[QUINATE-5-DEHYDROGENASE-RXN]]
-* [[DIOHBUTANONEPSYN-RXN]]
+* [[RXN-7967]]
-* [[FORMATETHFLIG-RXN]]
-* [[FORMYLTHFDEFORMYL-RXN]]
-* [[GTP-CYCLOHYDRO-I-RXN]]
-* [[GTP-CYCLOHYDRO-II-RXN]]
-* [[KETOBUTFORMLY-RXN]]
-* [[R147-RXN]]
-* [[RXN-11881]]
-* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=formate}}
+{{#set: common-name=3-dehydroquinate}}
-{{#set: molecular-weight=45.018}}
+{{#set: molecular-weight=189.144}}
-{{#set: inchi-key=inchikey=bdagihxwwsansr-uhfffaoysa-m}}
+{{#set: inchi-key=inchikey=wvmwzwgzraxubk-sytvjdicsa-m}}