Difference between revisions of "CPD-14378"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CROTONYL-COA == * common-name: ** crotonyl-coa * molecular-weight: ** 831.577 * inchi-key: ** kfwwcmjsysspsk-bogfjhsmsa-j * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite CPD-14378 == * common-name: ** dehydrospermidine * molecular-weight: ** 146.255 * inchi-key: ** yavlybvkpxlzeq-uxblzvdnsa-q * smiles: **...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CROTONYL-COA ==
+
== Metabolite CPD-14378 ==
 
* common-name:
 
* common-name:
** crotonyl-coa
+
** dehydrospermidine
 
* molecular-weight:
 
* molecular-weight:
** 831.577
+
** 146.255
 
* inchi-key:
 
* inchi-key:
** kfwwcmjsysspsk-bogfjhsmsa-j
+
** yavlybvkpxlzeq-uxblzvdnsa-q
 
* smiles:
 
* smiles:
** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
+
** c([n+])cc[n+]=cccc[n+]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
+
* [[RXN-13415]]
* [[RXN-11667]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
+
* [[RXN-13414]]
* [[RXN-11667]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=crotonyl-coa}}
+
{{#set: common-name=dehydrospermidine}}
{{#set: molecular-weight=831.577}}
+
{{#set: molecular-weight=146.255}}
{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}
+
{{#set: inchi-key=inchikey=yavlybvkpxlzeq-uxblzvdnsa-q}}

Latest revision as of 19:35, 17 March 2021

Metabolite CPD-14378

  • common-name:
    • dehydrospermidine
  • molecular-weight:
    • 146.255
  • inchi-key:
    • yavlybvkpxlzeq-uxblzvdnsa-q
  • smiles:
    • c([n+])cc[n+]=cccc[n+]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality