Difference between revisions of "MG+2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14604 == * common-name: ** mycophenolic acid phenolic glucuronide * molecular-weight: ** 494.451 * inchi-key: ** byfgtsayqqiucn-hgihd...")
(Created page with "Category:metabolite == Metabolite MG+2 == * common-name: ** mg2+ * molecular-weight: ** 24.305 * inchi-key: ** jlvvsxflkojniy-uhfffaoysa-n * smiles: ** [mg++] == Reaction(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14604 ==
+
== Metabolite MG+2 ==
 
* common-name:
 
* common-name:
** mycophenolic acid phenolic glucuronide
+
** mg2+
 
* molecular-weight:
 
* molecular-weight:
** 494.451
+
** 24.305
 
* inchi-key:
 
* inchi-key:
** byfgtsayqqiucn-hgihdbqlsa-l
+
** jlvvsxflkojniy-uhfffaoysa-n
 
* smiles:
 
* smiles:
** cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))2)3))oc)
+
** [mg++]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ExchangeSeed-MG+2]]
 +
* [[RXN1F-20]]
 +
* [[TransportSeed-MG+2]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13608]]
+
* [[ExchangeSeed-MG+2]]
 +
* [[TransportSeed-MG+2]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=mycophenolic acid phenolic glucuronide}}
+
{{#set: common-name=mg2+}}
{{#set: molecular-weight=494.451}}
+
{{#set: molecular-weight=24.305}}
{{#set: inchi-key=inchikey=byfgtsayqqiucn-hgihdbqlsa-l}}
+
{{#set: inchi-key=inchikey=jlvvsxflkojniy-uhfffaoysa-n}}

Latest revision as of 19:35, 17 March 2021

Metabolite MG+2

  • common-name:
    • mg2+
  • molecular-weight:
    • 24.305
  • inchi-key:
    • jlvvsxflkojniy-uhfffaoysa-n
  • smiles:
    • [mg++]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality