Difference between revisions of "CPD-10283"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * molecular-weight: ** 165.191 * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * smiles: ** c([o-])(...")
(Created page with "Category:metabolite == Metabolite CPD-10283 == * common_name: ** 3-oxo-behenoyl-coa * smiles: ** cccccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHE ==
+
== Metabolite CPD-10283 ==
* common-name:
+
* common_name:
** l-phenylalanine
+
** 3-oxo-behenoyl-coa
* molecular-weight:
 
** 165.191
 
* inchi-key:
 
** colnvldhvkwlrt-qmmmgpobsa-n
 
 
* smiles:
 
* smiles:
** c([o-])(=o)c([n+])cc1(c=cc=cc=1)
+
** cccccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 +
* inchi_key:
 +
** inchikey=rkcogguhkptoqj-gnsuaqhmsa-j
 +
* molecular_weight:
 +
** 1100.059   
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.58-RXN]]
+
* [[RXN-13299]]
* [[PHEAMINOTRANS-RXN]]
 
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 
* [[RXN-10814]]
 
* [[RXN-17130]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.58-RXN]]
+
* [[RXN-13295]]
* [[CARBOXYCYCLOHEXADIENYL-DEHYDRATASE-RXN]]
 
* [[PHEAMINOTRANS-RXN]]
 
* [[RXN-10814]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-phenylalanine}}
+
{{#set: common_name=3-oxo-behenoyl-coa}}
{{#set: molecular-weight=165.191}}
+
{{#set: inchi_key=inchikey=rkcogguhkptoqj-gnsuaqhmsa-j}}
{{#set: inchi-key=inchikey=colnvldhvkwlrt-qmmmgpobsa-n}}
+
{{#set: molecular_weight=1100.059    }}

Latest revision as of 19:35, 17 March 2021

Metabolite CPD-10283

  • common_name:
    • 3-oxo-behenoyl-coa
  • smiles:
    • cccccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi_key:
    • inchikey=rkcogguhkptoqj-gnsuaqhmsa-j
  • molecular_weight:
    • 1100.059

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality