Difference between revisions of "PHE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Retinols == * common-name: ** a retinol == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == *...") |
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * molecular-weight: ** 165.191 * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * smiles: ** c([o-])(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-phenylalanine |
| + | * molecular-weight: | ||
| + | ** 165.191 | ||
| + | * inchi-key: | ||
| + | ** colnvldhvkwlrt-qmmmgpobsa-n | ||
| + | * smiles: | ||
| + | ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.6.1.58-RXN]] | ||
| + | * [[PHEAMINOTRANS-RXN]] | ||
| + | * [[PHENYLALANINE--TRNA-LIGASE-RXN]] | ||
| + | * [[RXN-10814]] | ||
| + | * [[RXN-17130]] | ||
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.6.1.58-RXN]] |
| + | * [[CARBOXYCYCLOHEXADIENYL-DEHYDRATASE-RXN]] | ||
| + | * [[PHEAMINOTRANS-RXN]] | ||
| + | * [[RXN-10814]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-phenylalanine}} |
| + | {{#set: molecular-weight=165.191}} | ||
| + | {{#set: inchi-key=inchikey=colnvldhvkwlrt-qmmmgpobsa-n}} | ||
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite PHE
- common-name:
- l-phenylalanine
- molecular-weight:
- 165.191
- inchi-key:
- colnvldhvkwlrt-qmmmgpobsa-n
- smiles:
- c([o-])(=o)c([n+])cc1(c=cc=cc=1)
