Difference between revisions of "3-DEHYDRO-SHIKIMATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLY == * common-name: ** glycine * molecular-weight: ** 75.067 * inchi-key: ** dhmqdgoqfoqnfh-uhfffaoysa-n * smiles: ** c([n+])c([o-])=o...") |
(Created page with "Category:metabolite == Metabolite 3-DEHYDRO-SHIKIMATE == * common-name: ** 3-dehydroshikimate * molecular-weight: ** 171.129 * inchi-key: ** slwwjzmphjjoph-phdidxhhsa-m *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-DEHYDRO-SHIKIMATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-dehydroshikimate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 171.129 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** slwwjzmphjjoph-phdidxhhsa-m |
* smiles: | * smiles: | ||
| − | ** c([ | + | ** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
| − | + | * [[SHIKIMATE-5-DEHYDROGENASE-RXN]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]] |
| − | + | * [[RXN-7968]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-dehydroshikimate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=171.129}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=slwwjzmphjjoph-phdidxhhsa-m}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite 3-DEHYDRO-SHIKIMATE
- common-name:
- 3-dehydroshikimate
- molecular-weight:
- 171.129
- inchi-key:
- slwwjzmphjjoph-phdidxhhsa-m
- smiles:
- c([o-])(=o)c1(=cc(=o)c(o)c(o)c1)
