Difference between revisions of "Saturated-Fatty-Acyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROPIONYL-COA == * common-name: ** propanoyl-coa * molecular-weight: ** 819.566 * inchi-key: ** qaqrevbbadehpa-iexphmlfsa-j * smiles: **...")
(Created page with "Category:metabolite == Metabolite Saturated-Fatty-Acyl-ACPs == * common-name: ** a 2,3,4-saturated fatty acyl-[acp] == Reaction(s) known to consume the compound == * 3-O...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROPIONYL-COA ==
+
== Metabolite Saturated-Fatty-Acyl-ACPs ==
 
* common-name:
 
* common-name:
** propanoyl-coa
+
** a 2,3,4-saturated fatty acyl-[acp]
* molecular-weight:
 
** 819.566
 
* inchi-key:
 
** qaqrevbbadehpa-iexphmlfsa-j
 
* smiles:
 
** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHYLACETOACETYLCOATHIOL-RXN]]
+
* [[3-OXOACYL-ACP-SYNTH-RXN]]
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.2.1.27-RXN]]
+
* [[ENOYL-ACP-REDUCT-NADH-RXN]]
* [[2.3.1.176-RXN]]
+
* [[ENOYL-ACP-REDUCT-NADPH-RXN]]
* [[KETOBUTFORMLY-RXN]]
 
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
* [[RXN-11213]]
 
* [[RXN-12561]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=propanoyl-coa}}
+
{{#set: common-name=a 2,3,4-saturated fatty acyl-[acp]}}
{{#set: molecular-weight=819.566}}
 
{{#set: inchi-key=inchikey=qaqrevbbadehpa-iexphmlfsa-j}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite Saturated-Fatty-Acyl-ACPs

  • common-name:
    • a 2,3,4-saturated fatty acyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 2,3,4-saturated fatty acyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.