Difference between revisions of "DEOXYINOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite C-DI-GMP == * common-name: ** cyclic di-3',5'-guanylate * molecular-weight: ** 688.4 * inchi-key: ** pkfdlksezwefgl-mharetsrsa-l * smiles...") |
(Created page with "Category:metabolite == Metabolite DEOXYINOSINE == * common-name: ** 2'-deoxyinosine * molecular-weight: ** 252.229 * inchi-key: ** vgontnsxdcqugy-rrkcrqdmsa-n * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DEOXYINOSINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2'-deoxyinosine |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 252.229 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** vgontnsxdcqugy-rrkcrqdmsa-n |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23))) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ADDALT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2'-deoxyinosine}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=252.229}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vgontnsxdcqugy-rrkcrqdmsa-n}} |
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite DEOXYINOSINE
- common-name:
- 2'-deoxyinosine
- molecular-weight:
- 252.229
- inchi-key:
- vgontnsxdcqugy-rrkcrqdmsa-n
- smiles:
- c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23)))
