Difference between revisions of "IS30-Insertion-Sequences"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14736 == * common-name: ** l-kynurenine * molecular-weight: ** 208.216 * inchi-key: ** ygpsjzoedvaxab-qmmmgpobsa-n * smiles: ** c(=o)...")
(Created page with "Category:metabolite == Metabolite IS30-Insertion-Sequences == * common_name: ** an insertion sequence element is30 == Reaction(s) known to consume the compound == * RXN0...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14736 ==
+
== Metabolite IS30-Insertion-Sequences ==
* common-name:
+
* common_name:
** l-kynurenine
+
** an insertion sequence element is30
* molecular-weight:
 
** 208.216
 
* inchi-key:
 
** ygpsjzoedvaxab-qmmmgpobsa-n
 
* smiles:
 
** c(=o)([o-])c([n+])cc(=o)c1(=c(n)c=cc=c1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.63-RXN]]
+
* [[RXN0-5131]]
* [[2.6.1.7-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.63-RXN]]
+
* [[RXN0-5131]]
* [[2.6.1.7-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-kynurenine}}
+
{{#set: common_name=an insertion sequence element is30}}
{{#set: molecular-weight=208.216}}
 
{{#set: inchi-key=inchikey=ygpsjzoedvaxab-qmmmgpobsa-n}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite IS30-Insertion-Sequences

  • common_name:
    • an insertion sequence element is30

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality