Difference between revisions of "34-DIHYDROXYPHENYLACETALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INOSITOL-1-3-4-TRIPHOSPHATE == * common-name: ** d-myo-inositol (1,3,4)-trisphosphate * molecular-weight: ** 414.049 * inchi-key: ** mmwc...")
(Created page with "Category:metabolite == Metabolite 34-DIHYDROXYPHENYLACETALDEHYDE == * common-name: ** 3,4-dihydroxyphenylacetaldehyde * molecular-weight: ** 152.149 * inchi-key: ** iadqvx...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INOSITOL-1-3-4-TRIPHOSPHATE ==
+
== Metabolite 34-DIHYDROXYPHENYLACETALDEHYDE ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4)-trisphosphate
+
** 3,4-dihydroxyphenylacetaldehyde
 
* molecular-weight:
 
* molecular-weight:
** 414.049
+
** 152.149
 
* inchi-key:
 
* inchi-key:
** mmwciqzxvozegg-mlqgymepsa-h
+
** iadqvxrmsniuel-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
+
** c1(=cc(=c(o)c=c1c[ch]=o)o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.133-RXN]]
+
* [[RXN6666-5]]
* [[2.7.1.139-RXN]]
 
* [[RXN-10939]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8730]]
+
* [[RXN6666-4]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4)-trisphosphate}}
+
{{#set: common-name=3,4-dihydroxyphenylacetaldehyde}}
{{#set: molecular-weight=414.049}}
+
{{#set: molecular-weight=152.149}}
{{#set: inchi-key=inchikey=mmwciqzxvozegg-mlqgymepsa-h}}
+
{{#set: inchi-key=inchikey=iadqvxrmsniuel-uhfffaoysa-n}}

Latest revision as of 19:35, 17 March 2021

Metabolite 34-DIHYDROXYPHENYLACETALDEHYDE

  • common-name:
    • 3,4-dihydroxyphenylacetaldehyde
  • molecular-weight:
    • 152.149
  • inchi-key:
    • iadqvxrmsniuel-uhfffaoysa-n
  • smiles:
    • c1(=cc(=c(o)c=c1c[ch]=o)o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality