Difference between revisions of "PRPP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17050 == * common-name: ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine * molecular-weight: ** 296.358 * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite PRPP == * common-name: ** 5-phospho-α-d-ribose 1-diphosphate * molecular-weight: ** 385.031 * inchi-key: ** pqgcedqwhsbajp-txicztdv...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17050 ==
+
== Metabolite PRPP ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
+
** 5-phospho-α-d-ribose 1-diphosphate
 
* molecular-weight:
 
* molecular-weight:
** 296.358
+
** 385.031
 
* inchi-key:
 
* inchi-key:
** poiijaagmgnxlo-vxgbxaggsa-n
+
** pqgcedqwhsbajp-txicztdvsa-i
 
* smiles:
 
* smiles:
** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3)
+
** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o)c(o)1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ADENPRIBOSYLTRAN-RXN]]
 +
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 +
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 +
* [[OROPRIBTRANS-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[PRPPSYN-RXN]]
 +
* [[PRTRANS-RXN]]
 +
* [[QUINOPRIBOTRANS-RXN]]
 +
* [[RXN-14270]]
 +
* [[URACIL-PRIBOSYLTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15684]]
+
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 +
* [[OROPRIBTRANS-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[PRPPSYN-RXN]]
 +
* [[PRTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=5-phospho-α-d-ribose 1-diphosphate}}
{{#set: molecular-weight=296.358}}
+
{{#set: molecular-weight=385.031}}
{{#set: inchi-key=inchikey=poiijaagmgnxlo-vxgbxaggsa-n}}
+
{{#set: inchi-key=inchikey=pqgcedqwhsbajp-txicztdvsa-i}}

Latest revision as of 19:35, 17 March 2021

Metabolite PRPP

  • common-name:
    • 5-phospho-α-d-ribose 1-diphosphate
  • molecular-weight:
    • 385.031
  • inchi-key:
    • pqgcedqwhsbajp-txicztdvsa-i
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o)c(o)1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality