Difference between revisions of "AICAR"

Latest revision as of 19:35, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-2743 ==
+== Metabolite AICAR ==
 * common-name:
-** nicotine-1'-n-oxide
+** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
 * molecular-weight:
-** 178.233
+** 336.197
 * inchi-key:
-** rwfbqhicrcuqjj-nuhjpdehsa-n
+** notgfiuvdgnkri-uuokfmhzsa-l
 * smiles:
-** c1(cc[ch](n(=o)(c)1)c2(=cn=cc=c2))
+** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
 == Reaction(s) known to consume the compound ==
+* [[AICARSYN-RXN]]
+* [[AICARTRANSFORM-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN66-81]]
+* [[AICARSYN-RXN]]
+* [[AICARTRANSFORM-RXN]]
+* [[GLUTAMIDOTRANS-RXN]]
+* [[RXN-14270]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=nicotine-1'-n-oxide}}
+{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide}}
-{{#set: molecular-weight=178.233}}
+{{#set: molecular-weight=336.197}}
-{{#set: inchi-key=inchikey=rwfbqhicrcuqjj-nuhjpdehsa-n}}
+{{#set: inchi-key=inchikey=notgfiuvdgnkri-uuokfmhzsa-l}}