Difference between revisions of "CPD-468"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-Alpha-Acetylated-N-terminal-Amino-Acid == * common_name: ** an nα-acetylated [protein] n-terminal amino acid == Reaction(s) known...") |
(Created page with "Category:metabolite == Metabolite CPD-468 == * common-name: ** l-2-aminoadipate * molecular-weight: ** 160.149 * inchi-key: ** oyifnhcxncrbqi-bypyzucnsa-m * smiles: ** c([...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-468 == |
| − | * | + | * common-name: |
| − | ** | + | ** l-2-aminoadipate |
| + | * molecular-weight: | ||
| + | ** 160.149 | ||
| + | * inchi-key: | ||
| + | ** oyifnhcxncrbqi-bypyzucnsa-m | ||
| + | * smiles: | ||
| + | ** c([o-])(=o)cccc(c(=o)[o-])[n+] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-5181]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-5181]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=l-2-aminoadipate}} |
| + | {{#set: molecular-weight=160.149}} | ||
| + | {{#set: inchi-key=inchikey=oyifnhcxncrbqi-bypyzucnsa-m}} | ||
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite CPD-468
- common-name:
- l-2-aminoadipate
- molecular-weight:
- 160.149
- inchi-key:
- oyifnhcxncrbqi-bypyzucnsa-m
- smiles:
- c([o-])(=o)cccc(c(=o)[o-])[n+]
