Difference between revisions of "5-ppp-Pur-mRNA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-GLUTAMYL-P == * common-name: ** n-acetylglutamyl-phosphate * molecular-weight: ** 266.124 * inchi-key: ** fcvihfvsxhopsw-yfkpbyr...")
(Created page with "Category:metabolite == Metabolite 5-ppp-Pur-mRNA == * common-name: ** a 5'-triphospho-purine-[mrna] == Reaction(s) known to consume the compound == * POLYNUCLEOTIDE-5-PH...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-ACETYL-GLUTAMYL-P ==
+
== Metabolite 5-ppp-Pur-mRNA ==
 
* common-name:
 
* common-name:
** n-acetylglutamyl-phosphate
+
** a 5'-triphospho-purine-[mrna]
* molecular-weight:
 
** 266.124
 
* inchi-key:
 
** fcvihfvsxhopsw-yfkpbyrvsa-k
 
* smiles:
 
** cc(=o)nc(c([o-])=o)ccc(=o)op([o-])(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[POLYNUCLEOTIDE-5-PHOSPHATASE-RXN]]
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLGLUTKIN-RXN]]
 
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetylglutamyl-phosphate}}
+
{{#set: common-name=a 5'-triphospho-purine-[mrna]}}
{{#set: molecular-weight=266.124}}
 
{{#set: inchi-key=inchikey=fcvihfvsxhopsw-yfkpbyrvsa-k}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite 5-ppp-Pur-mRNA

  • common-name:
    • a 5'-triphospho-purine-[mrna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-triphospho-purine-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.