Difference between revisions of "CPD-12015"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1027 == * common-name: ** a debranched α-limit dextrin == Reaction(s) known to consume the compound == * RXN-9025 == React...") |
(Created page with "Category:metabolite == Metabolite CPD-12015 == * common-name: ** 6-sulfatoxymelatonin * molecular-weight: ** 327.331 * inchi-key: ** qqeilxdlzrltme-uhfffaoysa-m * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12015 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-sulfatoxymelatonin |
| + | * molecular-weight: | ||
| + | ** 327.331 | ||
| + | * inchi-key: | ||
| + | ** qqeilxdlzrltme-uhfffaoysa-m | ||
| + | * smiles: | ||
| + | ** cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11058]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-sulfatoxymelatonin}} |
| + | {{#set: molecular-weight=327.331}} | ||
| + | {{#set: inchi-key=inchikey=qqeilxdlzrltme-uhfffaoysa-m}} | ||
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite CPD-12015
- common-name:
- 6-sulfatoxymelatonin
- molecular-weight:
- 327.331
- inchi-key:
- qqeilxdlzrltme-uhfffaoysa-m
- smiles:
- cc(=o)nccc1(c2(=c(nc=1)c=c(os([o-])(=o)=o)c(oc)=c2))
