Difference between revisions of "D-SERINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P == * common-name: ** phosphoribulosylformimino-aicar-phosphate * molecular-weight: ** 573.303 * inchi-...")
(Created page with "Category:metabolite == Metabolite D-SERINE == * common-name: ** d-serine * molecular-weight: ** 105.093 * inchi-key: ** mtcfgrxmjlqnbg-uwtatzphsa-n * smiles: ** c(o)c([n+]...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P ==
+
== Metabolite D-SERINE ==
 
* common-name:
 
* common-name:
** phosphoribulosylformimino-aicar-phosphate
+
** d-serine
 
* molecular-weight:
 
* molecular-weight:
** 573.303
+
** 105.093
 
* inchi-key:
 
* inchi-key:
** blkfnhochnclii-ghvqhmavsa-j
+
** mtcfgrxmjlqnbg-uwtatzphsa-n
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
+
** c(o)c([n+])c(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUTAMIDOTRANS-RXN]]
+
* [[DSERDEAM-RXN]]
 +
* [[RXN-15581]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PRIBFAICARPISOM-RXN]]
+
* [[5.1.1.18-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phosphoribulosylformimino-aicar-phosphate}}
+
{{#set: common-name=d-serine}}
{{#set: molecular-weight=573.303}}
+
{{#set: molecular-weight=105.093}}
{{#set: inchi-key=inchikey=blkfnhochnclii-ghvqhmavsa-j}}
+
{{#set: inchi-key=inchikey=mtcfgrxmjlqnbg-uwtatzphsa-n}}

Latest revision as of 19:36, 17 March 2021

Metabolite D-SERINE

  • common-name:
    • d-serine
  • molecular-weight:
    • 105.093
  • inchi-key:
    • mtcfgrxmjlqnbg-uwtatzphsa-n
  • smiles:
    • c(o)c([n+])c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality