Difference between revisions of "CPD-1063"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CMP == * common-name: ** cmp * molecular-weight: ** 321.183 * inchi-key: ** ierhlvcpsmictf-xvfcmesisa-l * smiles: ** c(c2(c(c(c(n1(c(n=c(...") |
(Created page with "Category:metabolite == Metabolite CPD-1063 == * common-name: ** 5-(methylsulfanyl)-ribulose 1-phosphate * molecular-weight: ** 258.182 * inchi-key: ** cnsjryumvmwnmc-ritpc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-1063 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-(methylsulfanyl)-ribulose 1-phosphate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.182 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cnsjryumvmwnmc-ritpcoansa-l |
* smiles: | * smiles: | ||
| − | ** | + | ** cscc(o)c(o)c(=o)cop([o-])(=o)[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[R145-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[5.3.1.23-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-(methylsulfanyl)-ribulose 1-phosphate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.182}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cnsjryumvmwnmc-ritpcoansa-l}} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite CPD-1063
- common-name:
- 5-(methylsulfanyl)-ribulose 1-phosphate
- molecular-weight:
- 258.182
- inchi-key:
- cnsjryumvmwnmc-ritpcoansa-l
- smiles:
- cscc(o)c(o)c(=o)cop([o-])(=o)[o-]
