Difference between revisions of "CYTIDINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-369 == * common-name: ** l-iditol * molecular-weight: ** 182.173 * inchi-key: ** fbpfztcfmrresa-untfvmjosa-n * smiles: ** c(c(c(c(c(o...") |
(Created page with "Category:metabolite == Metabolite CYTIDINE == * common-name: ** cytidine * molecular-weight: ** 243.219 * inchi-key: ** uhdgcwiwmrvcdj-xvfcmesisa-n * smiles: ** c(c2(c(c(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CYTIDINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** cytidine |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 243.219 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uhdgcwiwmrvcdj-xvfcmesisa-n |
* smiles: | * smiles: | ||
| − | ** c(c(c(c(c(o) | + | ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[CYTIDEAM2-RXN]] |
| + | * [[CYTIKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14026]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cytidine}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=243.219}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uhdgcwiwmrvcdj-xvfcmesisa-n}} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite CYTIDINE
- common-name:
- cytidine
- molecular-weight:
- 243.219
- inchi-key:
- uhdgcwiwmrvcdj-xvfcmesisa-n
- smiles:
- c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))o
