Difference between revisions of "HS"

Latest revision as of 19:36, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite DGTP ==
+== Metabolite HS ==
 * common-name:
-** dgtp
+** hydrogen sulfide
 * molecular-weight:
-** 503.152
+** 34.076
 * inchi-key:
-** haazlughyhwqiw-kvqbguixsa-j
+** rwsotubldixvet-uhfffaoysa-n
 * smiles:
-** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+** [sh2]
 == Reaction(s) known to consume the compound ==
-* [[RXN-11410]]
+* [[ACSERLY-RXN]]
-* [[RXN0-385]]
+* [[RXN-10851]]
+* [[RXN-11923]]
+* [[RXN-15348]]
+* [[RXN-9384]]
+* [[SULFITE-REDUCTASE-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[DGDPKIN-RXN]]
+* [[ACSERLY-RXN]]
-* [[RXN-14207]]
+* [[LCYSDESULF-RXN]]
+* [[MERCAPYSTRANS-RXN]]
+* [[RXN-10851]]
+* [[RXN-15129]]
+* [[RXN-9384]]
+* [[SULFITE-REDUCT-RXN]]
+* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
+* [[SULFITE-REDUCTASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=dgtp}}
+{{#set: common-name=hydrogen sulfide}}
-{{#set: molecular-weight=503.152}}
+{{#set: molecular-weight=34.076}}
-{{#set: inchi-key=inchikey=haazlughyhwqiw-kvqbguixsa-j}}
+{{#set: inchi-key=inchikey=rwsotubldixvet-uhfffaoysa-n}}