Difference between revisions of "4-P-PANTOTHENATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-phosphooligonucleotides == * common_name: ** a 3' phosphooligonucleotide == Reaction(s) known to consume the compound == == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite 4-P-PANTOTHENATE == * common-name: ** (r)-4'-phosphopantothenate * molecular-weight: ** 296.193 * inchi-key: ** xhfvghpgdldeqo-zetcqymhsa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-P-PANTOTHENATE == |
| − | * | + | * common-name: |
| − | ** | + | ** (r)-4'-phosphopantothenate |
| + | * molecular-weight: | ||
| + | ** 296.193 | ||
| + | * inchi-key: | ||
| + | ** xhfvghpgdldeqo-zetcqymhsa-k | ||
| + | * smiles: | ||
| + | ** cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PANTOTHENATE-KIN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=(r)-4'-phosphopantothenate}} |
| + | {{#set: molecular-weight=296.193}} | ||
| + | {{#set: inchi-key=inchikey=xhfvghpgdldeqo-zetcqymhsa-k}} | ||
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite 4-P-PANTOTHENATE
- common-name:
- (r)-4'-phosphopantothenate
- molecular-weight:
- 296.193
- inchi-key:
- xhfvghpgdldeqo-zetcqymhsa-k
- smiles:
- cc(c(c(=o)nccc(=o)[o-])o)(cop([o-])([o-])=o)c
