Difference between revisions of "2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16483 == * common-name: ** an n-acetyl-α-neuraminyl-(2→6)-β-d-galactosyl-(1→4)-n-acetyl-β-d-glucosaminyl-r...")
(Created page with "Category:metabolite == Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP == * common-name: ** 2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate * molecular-weigh...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-16483 ==
+
== Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP ==
 
* common-name:
 
* common-name:
** an n-acetyl-α-neuraminyl-(2→6)-β-d-galactosyl-(1→4)-n-acetyl-β-d-glucosaminyl-r
+
** 2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate
 +
* molecular-weight:
 +
** 239.159
 +
* inchi-key:
 +
** yiemfvncenfbsd-xqrvvysfsa-k
 
* smiles:
 
* smiles:
** cc(=o)nc3(c(cc(c([o-])=o)(occ1(c(o)c(o)c(o)c(o1)oc2(c(co)oc(c(nc(c)=o)c(o)2)o[r])))o[ch]3c(o)c(o)co)o)
+
** csccc(c([o-])=cop([o-])(=o)[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[R83-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15271]]
+
* [[R82-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n-acetyl-α-neuraminyl-(2→6)-β-d-galactosyl-(1→4)-n-acetyl-β-d-glucosaminyl-r}}
+
{{#set: common-name=2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate}}
 +
{{#set: molecular-weight=239.159}}
 +
{{#set: inchi-key=inchikey=yiemfvncenfbsd-xqrvvysfsa-k}}

Latest revision as of 19:36, 17 March 2021

Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP

  • common-name:
    • 2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate
  • molecular-weight:
    • 239.159
  • inchi-key:
    • yiemfvncenfbsd-xqrvvysfsa-k
  • smiles:
    • csccc(c([o-])=cop([o-])(=o)[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality