Difference between revisions of "CPD-2961"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == * common_name: ** β-d-galactosyl-1,4-n-acetyl-β-d-glucosamine * smiles: ** cc(=o)nc2(...") |
(Created page with "Category:metabolite == Metabolite CPD-2961 == * common-name: ** d-gluconate 6-phosphate * molecular-weight: ** 273.113 * inchi-key: ** birsgzkfkxlsjq-sqougzdysa-k * smiles...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-2961 == |
| − | * | + | * common-name: |
| − | ** | + | ** d-gluconate 6-phosphate |
| + | * molecular-weight: | ||
| + | ** 273.113 | ||
| + | * inchi-key: | ||
| + | ** birsgzkfkxlsjq-sqougzdysa-k | ||
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[6PGLUCONDEHYDROG-RXN]] |
| + | * [[RXN-3341]] | ||
| + | * [[RXN-9952]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[6PGLUCONOLACT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=d-gluconate 6-phosphate}} |
| − | {{#set: | + | {{#set: molecular-weight=273.113}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=birsgzkfkxlsjq-sqougzdysa-k}} |
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite CPD-2961
- common-name:
- d-gluconate 6-phosphate
- molecular-weight:
- 273.113
- inchi-key:
- birsgzkfkxlsjq-sqougzdysa-k
- smiles:
- c(c(c(c(c(c([o-])=o)o)o)o)o)op([o-])([o-])=o
