Difference between revisions of "2-LYSOPHOSPHATIDYLETHANOLAMINES"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8117 == * common-name: ** γ-linolenate * molecular-weight: ** 277.426 * inchi-key: ** vzccetwtmqhepk-qnebeihssa-m * smiles: **...")
(Created page with "Category:metabolite == Metabolite 2-LYSOPHOSPHATIDYLETHANOLAMINES == * common-name: ** a 1-acyl,2-lyso-phosphatidylethanolamine == Reaction(s) known to consume the compoun...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8117 ==
+
== Metabolite 2-LYSOPHOSPHATIDYLETHANOLAMINES ==
 
* common-name:
 
* common-name:
** γ-linolenate
+
** a 1-acyl,2-lyso-phosphatidylethanolamine
* molecular-weight:
 
** 277.426
 
* inchi-key:
 
** vzccetwtmqhepk-qnebeihssa-m
 
* smiles:
 
** cccccc=ccc=ccc=cccccc(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R07063]]
+
* [[RXN0-6725]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-linolenate}}
+
{{#set: common-name=a 1-acyl,2-lyso-phosphatidylethanolamine}}
{{#set: molecular-weight=277.426}}
 
{{#set: inchi-key=inchikey=vzccetwtmqhepk-qnebeihssa-m}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite 2-LYSOPHOSPHATIDYLETHANOLAMINES

  • common-name:
    • a 1-acyl,2-lyso-phosphatidylethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality