Difference between revisions of "PHENYL-PYRUVATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-Hexoses == * common-name: ** a d-hexose == Reaction(s) known to consume the compound == * HEXOKINASE-RXN == Reaction(s) known to pr...")
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** 3-phenyl-2-oxopropanoate * molecular-weight: ** 163.152 * inchi-key: ** btnmpgbkdvtsjy-uhfffaoysa-m...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-Hexoses ==
+
== Metabolite PHENYL-PYRUVATE ==
 
* common-name:
 
* common-name:
** a d-hexose
+
** 3-phenyl-2-oxopropanoate
 +
* molecular-weight:
 +
** 163.152
 +
* inchi-key:
 +
** btnmpgbkdvtsjy-uhfffaoysa-m
 +
* smiles:
 +
** c([o-])(=o)c(=o)cc1(=cc=cc=c1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HEXOKINASE-RXN]]
+
* [[2.6.1.58-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PHENYLPYRUVATE-TAUTOMERASE-RXN]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 +
* [[RXN-10814]]
 +
* [[RXN-10815]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEXOKINASE-RXN]]
+
* [[2.6.1.58-RXN]]
 +
* [[PHEAMINOTRANS-RXN]]
 +
* [[PREPHENATEDEHYDRAT-RXN]]
 +
* [[RXN-10814]]
 +
* [[RXN-17130]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a d-hexose}}
+
{{#set: common-name=3-phenyl-2-oxopropanoate}}
 +
{{#set: molecular-weight=163.152}}
 +
{{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}}

Latest revision as of 19:37, 17 March 2021

Metabolite PHENYL-PYRUVATE

  • common-name:
    • 3-phenyl-2-oxopropanoate
  • molecular-weight:
    • 163.152
  • inchi-key:
    • btnmpgbkdvtsjy-uhfffaoysa-m
  • smiles:
    • c([o-])(=o)c(=o)cc1(=cc=cc=c1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality