Difference between revisions of "TETRADECANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-octaprenyl-4-hydroxybenzoate * molecular-weight: ** 682.06 * inchi-key: ** utibhebn...")
(Created page with "Category:metabolite == Metabolite TETRADECANOYL-COA == * common-name: ** myristoyl-coa * molecular-weight: ** 973.861 * inchi-key: ** duafkxofbzqtqe-qsgbvpjfsa-j * smiles:...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-OCTAPRENYL-4-HYDROXYBENZOATE ==
+
== Metabolite TETRADECANOYL-COA ==
 
* common-name:
 
* common-name:
** 3-octaprenyl-4-hydroxybenzoate
+
** myristoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 682.06
+
** 973.861
 
* inchi-key:
 
* inchi-key:
** utibhebnildqkx-lqokpsqisa-m
+
** duafkxofbzqtqe-qsgbvpjfsa-j
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c)c)c)c
+
** cccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14131]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
+
* [[2.3.1.155-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-octaprenyl-4-hydroxybenzoate}}
+
{{#set: common-name=myristoyl-coa}}
{{#set: molecular-weight=682.06}}
+
{{#set: molecular-weight=973.861}}
{{#set: inchi-key=inchikey=utibhebnildqkx-lqokpsqisa-m}}
+
{{#set: inchi-key=inchikey=duafkxofbzqtqe-qsgbvpjfsa-j}}

Latest revision as of 19:37, 17 March 2021

Metabolite TETRADECANOYL-COA

  • common-name:
    • myristoyl-coa
  • molecular-weight:
    • 973.861
  • inchi-key:
    • duafkxofbzqtqe-qsgbvpjfsa-j
  • smiles:
    • cccccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality