Difference between revisions of "UMP"

Latest revision as of 19:37, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 5-AMINO-LEVULINATE ==
+== Metabolite UMP ==
 * common-name:
-** 5-aminolevulinate
+** ump
 * molecular-weight:
-** 131.131
+** 322.168
 * inchi-key:
-** zgxjtsgniosylo-uhfffaoysa-n
+** djjcxfvjdgthfx-xvfcmesisa-l
 * smiles:
-** c(c(c[n+])=o)cc([o-])=o
+** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 == Reaction(s) known to consume the compound ==
-* [[PORPHOBILSYNTH-RXN]]
+* [[RXN-12002]]
+* [[RXN-14025]]
+* [[RXN-8975]]
 == Reaction(s) known to produce the compound ==
-* [[GSAAMINOTRANS-RXN]]
+* [[2.7.8.15-RXN]]
+* [[OROTPDECARB-RXN]]
+* [[PHOSNACMURPENTATRANS-RXN]]
+* [[RXN-11347]]
+* [[RXN-12197]]
+* [[RXN-12199]]
+* [[RXN-14139]]
+* [[RXN-8975]]
+* [[URACIL-PRIBOSYLTRANS-RXN]]
+* [[URIDINEKIN-RXN]]
+* [[URKI-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5-aminolevulinate}}
+{{#set: common-name=ump}}
-{{#set: molecular-weight=131.131}}
+{{#set: molecular-weight=322.168}}
-{{#set: inchi-key=inchikey=zgxjtsgniosylo-uhfffaoysa-n}}
+{{#set: inchi-key=inchikey=djjcxfvjdgthfx-xvfcmesisa-l}}