Difference between revisions of "Cis-cis-D21-39-C58-2-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17348 == * common_name: ** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa * smiles: ** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)...")
(Created page with "Category:metabolite == Metabolite cis-cis-D21-39-C58-2-ACPs == * common-name: ** a cis,cis-delta21,39-c58:2-[acp] == Reaction(s) known to consume the compound == * RXN1G...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17348 ==
+
== Metabolite cis-cis-D21-39-C58-2-ACPs ==
* common_name:
+
* common-name:
** (2e, 11z,14z)-icosa-2,11,14-trienoyl-coa
+
** a cis,cis-delta21,39-c58:2-[acp]
* smiles:
 
** cccccc=ccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi_key:
 
** inchikey=jlhullpftgligf-dbyuabgnsa-j
 
* molecular_weight:
 
** 1051.975   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16097]]
+
* [[RXN1G-3613]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16096]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=(2e, 11z,14z)-icosa-2,11,14-trienoyl-coa}}
+
{{#set: common-name=a cis,cis-delta21,39-c58:2-[acp]}}
{{#set: inchi_key=inchikey=jlhullpftgligf-dbyuabgnsa-j}}
 
{{#set: molecular_weight=1051.975    }}
 

Latest revision as of 19:37, 17 March 2021

Metabolite cis-cis-D21-39-C58-2-ACPs

  • common-name:
    • a cis,cis-delta21,39-c58:2-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a cis,cis-delta21,39-c58:2-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.