Difference between revisions of "1-4-beta-Xylan"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE == * common-name: ** (2s)-2-isopropylmalate * molecular-weight: ** 174.153 * inchi-key: ** bityxlxucsktjs...")
(Created page with "Category:metabolite == Metabolite 1-4-beta-Xylan == * common-name: ** a (1→4)-β-d-xylan == Reaction(s) known to consume the compound == * 3.2.1.8-RXN == Reac...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-CARBOXY-3-HYDROXY-ISOCAPROATE ==
+
== Metabolite 1-4-beta-Xylan ==
 
* common-name:
 
* common-name:
** (2s)-2-isopropylmalate
+
** a (1→4)-β-d-xylan
* molecular-weight:
 
** 174.153
 
* inchi-key:
 
** bityxlxucsktjs-zetcqymhsa-l
 
* smiles:
 
** cc(c)c(o)(cc(=o)[o-])c([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-ISOPROPYLMALISOM-RXN]]
+
* [[3.2.1.8-RXN]]
* [[RXN-13163]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-ISOPROPYLMALATESYN-RXN]]
 
* [[3-ISOPROPYLMALISOM-RXN]]
 
* [[RXN-13163]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s)-2-isopropylmalate}}
+
{{#set: common-name=a (1→4)-β-d-xylan}}
{{#set: molecular-weight=174.153}}
 
{{#set: inchi-key=inchikey=bityxlxucsktjs-zetcqymhsa-l}}
 

Latest revision as of 19:33, 17 March 2021

Metabolite 1-4-beta-Xylan

  • common-name:
    • a (1→4)-β-d-xylan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality