Difference between revisions of "1-CHLORO-24-DINITROBENZENE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-Glucosyl-12-diacyl-glycerols == * common-name: ** a 1,2-diacyl-3-o-(β-d-glucopyranosyl)-sn-glycerol == Reaction(s) known to consum...") |
(Created page with "Category:metabolite == Metabolite 1-CHLORO-24-DINITROBENZENE == * common-name: ** 1-chloro-2,4-dinitrobenzene * molecular-weight: ** 202.554 * inchi-key: ** vyzahlcbvhpddf...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-CHLORO-24-DINITROBENZENE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-chloro-2,4-dinitrobenzene |
| + | * molecular-weight: | ||
| + | ** 202.554 | ||
| + | * inchi-key: | ||
| + | ** vyzahlcbvhpddf-uhfffaoysa-n | ||
| + | * smiles: | ||
| + | ** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[GST-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-chloro-2,4-dinitrobenzene}} |
| + | {{#set: molecular-weight=202.554}} | ||
| + | {{#set: inchi-key=inchikey=vyzahlcbvhpddf-uhfffaoysa-n}} | ||
Latest revision as of 19:36, 17 March 2021
Contents
Metabolite 1-CHLORO-24-DINITROBENZENE
- common-name:
- 1-chloro-2,4-dinitrobenzene
- molecular-weight:
- 202.554
- inchi-key:
- vyzahlcbvhpddf-uhfffaoysa-n
- smiles:
- c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o)
