Difference between revisions of "2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXYISOURATE == * common-name: ** (s)-5-hydroxyisourate * molecular-weight: ** 184.111 * inchi-key: ** ltqypavlayvktk-yfkpbyrvsa-n *...")
(Created page with "Category:metabolite == Metabolite 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L- == * common-name: ** a 2-[(3s)-3-carboxy-3-(methylammonio)propyl]-l-histidine-[translation elongatio...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 5-HYDROXYISOURATE ==
+
== Metabolite 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L- ==
 
* common-name:
 
* common-name:
−
** (s)-5-hydroxyisourate
+
** a 2-[(3s)-3-carboxy-3-(methylammonio)propyl]-l-histidine-[translation elongation factor 2]
−
* molecular-weight:
 
−
** 184.111
 
−
* inchi-key:
 
−
** ltqypavlayvktk-yfkpbyrvsa-n
 
−
* smiles:
 
−
** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[3.5.2.17-RXN]]
+
* [[RXN-11374]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[URATE-OXIDASE-RXN]]
+
* [[RXN-11370]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(s)-5-hydroxyisourate}}
+
{{#set: common-name=a 2-[(3s)-3-carboxy-3-(methylammonio)propyl]-l-histidine-[translation elongation factor 2]}}
−
{{#set: molecular-weight=184.111}}
 
−
{{#set: inchi-key=inchikey=ltqypavlayvktk-yfkpbyrvsa-n}}
 

Latest revision as of 19:35, 17 March 2021

Metabolite 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-

  • common-name:
    • a 2-[(3s)-3-carboxy-3-(methylammonio)propyl]-l-histidine-[translation elongation factor 2]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 2-[(3s)-3-carboxy-3-(methylammonio)propyl]-l-histidine-[translation elongation factor 2" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-&oldid=49595"