Difference between revisions of "23S-rRNA-guanine-1835"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLC-1-P == * common-name: ** α-d-glucopyranose 1-phosphate * molecular-weight: ** 258.121 * inchi-key: ** hxxfsfrbohsimq-vfuothlcsa...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-guanine-1835 == * common-name: ** a guanine1835 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11635 == R...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLC-1-P ==
+
== Metabolite 23S-rRNA-guanine-1835 ==
 
* common-name:
 
* common-name:
** α-d-glucopyranose 1-phosphate
+
** a guanine1835 in 23s rrna
* molecular-weight:
 
** 258.121
 
* inchi-key:
 
** hxxfsfrbohsimq-vfuothlcsa-l
 
* smiles:
 
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[RXN-11635]]
* [[GLUC1PADENYLTRANS-RXN]]
 
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[GLUCOSE-1-PHOSPHAT-RXN]]
 
* [[GLUCOSE-16-BISPHOSPHATE-SYNTHASE-RXN]]
 
* [[PHOSPHOGLUCMUT-RXN]]
 
* [[RXN-16997]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GALACTURIDYLYLTRANS-RXN]]
 
* [[GLUC1PURIDYLTRANS-RXN]]
 
* [[GLUCOSE-16-BISPHOSPHATE-SYNTHASE-RXN]]
 
* [[GLYCOPHOSPHORYL-RXN]]
 
* [[GLYMALTOPHOSPHORYL-RXN]]
 
* [[PHOSPHOGLUCMUT-RXN]]
 
* [[RXN-12171]]
 
* [[RXN-12392]]
 
* [[RXN-14284]]
 
* [[RXN-14285]]
 
* [[RXN-14286]]
 
* [[RXN-14353]]
 
* [[RXN-1826]]
 
* [[RXN-9025]]
 
* [[RXN0-5182]]
 
* [[RXN0-5184]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-glucopyranose 1-phosphate}}
+
{{#set: common-name=a guanine1835 in 23s rrna}}
{{#set: molecular-weight=258.121}}
 
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-vfuothlcsa-l}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite 23S-rRNA-guanine-1835

  • common-name:
    • a guanine1835 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality