Difference between revisions of "3-P-HYDROXYPYRUVATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cis-vaccenoyl-ACPs == * common-name: ** a cis-vaccenoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9555 == Reaction(...") |
(Created page with "Category:metabolite == Metabolite 3-P-HYDROXYPYRUVATE == * common-name: ** 3-phosphooxypyruvate * molecular-weight: ** 181.018 * inchi-key: ** lflucdosqpjjbe-uhfffaoysa-k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-P-HYDROXYPYRUVATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-phosphooxypyruvate |
| + | * molecular-weight: | ||
| + | ** 181.018 | ||
| + | * inchi-key: | ||
| + | ** lflucdosqpjjbe-uhfffaoysa-k | ||
| + | * smiles: | ||
| + | ** c(op([o-])(=o)[o-])c(=o)c(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[PGLYCDEHYDROG-RXN]] |
| + | * [[PSERTRANSAM-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[PGLYCDEHYDROG-RXN]] |
| + | * [[PSERTRANSAM-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-phosphooxypyruvate}} |
| + | {{#set: molecular-weight=181.018}} | ||
| + | {{#set: inchi-key=inchikey=lflucdosqpjjbe-uhfffaoysa-k}} | ||
Latest revision as of 19:34, 17 March 2021
Contents
Metabolite 3-P-HYDROXYPYRUVATE
- common-name:
- 3-phosphooxypyruvate
- molecular-weight:
- 181.018
- inchi-key:
- lflucdosqpjjbe-uhfffaoysa-k
- smiles:
- c(op([o-])(=o)[o-])c(=o)c(=o)[o-]
