Difference between revisions of "3-oxo-behenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite XANTHURENATE == * common-name: ** xanthurenate * molecular-weight: ** 203.154 * inchi-key: ** fbzonxhggphhiy-uhfffaoysa-l * smiles: ** c1...")
(Created page with "Category:metabolite == Metabolite 3-oxo-behenoyl-ACPs == * common-name: ** a 3-oxodocosanoyl-[acp] == Reaction(s) known to consume the compound == * RXN1G-157 * RXN1...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite XANTHURENATE ==
+
== Metabolite 3-oxo-behenoyl-ACPs ==
 
* common-name:
 
* common-name:
** xanthurenate
+
** a 3-oxodocosanoyl-[acp]
* molecular-weight:
 
** 203.154
 
* inchi-key:
 
** fbzonxhggphhiy-uhfffaoysa-l
 
* smiles:
 
** c1(=cc2(=c(c(o)=c1)n=c(c=c([o-])2)c(=o)[o-]))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1G-157]]
 +
* [[RXN1G-460]]
 +
* [[RXN1G-469]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10722]]
+
* [[RXN1G-445]]
 +
* [[RXN1G-460]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xanthurenate}}
+
{{#set: common-name=a 3-oxodocosanoyl-[acp]}}
{{#set: molecular-weight=203.154}}
 
{{#set: inchi-key=inchikey=fbzonxhggphhiy-uhfffaoysa-l}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite 3-oxo-behenoyl-ACPs

  • common-name:
    • a 3-oxodocosanoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxodocosanoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.