Difference between revisions of "3-oxo-cis-vaccenoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PANTETHEINE-P == * common-name: ** 4'-phosphopantetheine * molecular-weight: ** 356.33 * inchi-key: ** jdmuprlruumctl-vifpvbqesa-l * smil...")
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-vaccenoyl-ACPs == * common-name: ** an (11z)-3-oxooctadec-11-enoyl-[acp] == Reaction(s) known to consume the compound == * RX...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PANTETHEINE-P ==
+
== Metabolite 3-oxo-cis-vaccenoyl-ACPs ==
 
* common-name:
 
* common-name:
** 4'-phosphopantetheine
+
** an (11z)-3-oxooctadec-11-enoyl-[acp]
* molecular-weight:
 
** 356.33
 
* inchi-key:
 
** jdmuprlruumctl-vifpvbqesa-l
 
* smiles:
 
** cc(c(o)c(=o)nccc(nccs)=o)(c)cop([o-])(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PANTEPADENYLYLTRAN-RXN]]
+
* [[RXN-9556]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.4.14-RXN]]
+
* [[2.3.1.179-RXN]]
* [[P-PANTOCYSDECARB-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4'-phosphopantetheine}}
+
{{#set: common-name=an (11z)-3-oxooctadec-11-enoyl-[acp]}}
{{#set: molecular-weight=356.33}}
 
{{#set: inchi-key=inchikey=jdmuprlruumctl-vifpvbqesa-l}}
 

Latest revision as of 19:37, 17 March 2021

Metabolite 3-oxo-cis-vaccenoyl-ACPs

  • common-name:
    • an (11z)-3-oxooctadec-11-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an (11z)-3-oxooctadec-11-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.