Difference between revisions of "9Z-3-oxo-octadec-9-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-SULFOQUINOVOSE == * common-name: ** udp-α-d-sulfoquinovopyranose * molecular-weight: ** 627.34 * inchi-key: ** fqancgqcbcusmi-j...")
(Created page with "Category:metabolite == Metabolite 9Z-3-oxo-octadec-9-enoyl-ACPs == * common-name: ** a (9z)-3-oxo-octadec-9-enoyl-[acp] == Reaction(s) known to consume the compound == * [...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-SULFOQUINOVOSE ==
+
== Metabolite 9Z-3-oxo-octadec-9-enoyl-ACPs ==
 
* common-name:
 
* common-name:
** udp-α-d-sulfoquinovopyranose
+
** a (9z)-3-oxo-octadec-9-enoyl-[acp]
* molecular-weight:
 
** 627.34
 
* inchi-key:
 
** fqancgqcbcusmi-jzmiexbbsa-k
 
* smiles:
 
** c(op(=o)([o-])op(=o)(oc1(oc(cs(=o)(=o)[o-])c(o)c(o)c(o)1))[o-])c2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1224]]
+
* [[RXN-16626]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1223]]
+
* [[RXN-16625]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-α-d-sulfoquinovopyranose}}
+
{{#set: common-name=a (9z)-3-oxo-octadec-9-enoyl-[acp]}}
{{#set: molecular-weight=627.34}}
 
{{#set: inchi-key=inchikey=fqancgqcbcusmi-jzmiexbbsa-k}}
 

Latest revision as of 19:34, 17 March 2021

Metabolite 9Z-3-oxo-octadec-9-enoyl-ACPs

  • common-name:
    • a (9z)-3-oxo-octadec-9-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (9z)-3-oxo-octadec-9-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.