Difference between revisions of "ACETYL-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17386 == * common-name: ** (2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa * molecular-weight: ** 1100.019 * inchi-key: ** nvowzib...")
(Created page with "Category:metabolite == Metabolite ACETYL-P == * common-name: ** acetyl phosphate * molecular-weight: ** 138.016 * inchi-key: ** lipounrjvlnbcd-uhfffaoysa-l * smiles: ** cc...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17386 ==
+
== Metabolite ACETYL-P ==
 
* common-name:
 
* common-name:
** (2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa
+
** acetyl phosphate
 
* molecular-weight:
 
* molecular-weight:
** 1100.019
+
** 138.016
 
* inchi-key:
 
* inchi-key:
** nvowzibkqiwtdg-aducosnasa-j
+
** lipounrjvlnbcd-uhfffaoysa-l
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc(op([o-])(=o)[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16135]]
+
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16134]]
+
* [[LYSINE-N-ACETYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,6z,9z,12z,15z,18z,21z)-tetracosaheptaenoyl-coa}}
+
{{#set: common-name=acetyl phosphate}}
{{#set: molecular-weight=1100.019}}
+
{{#set: molecular-weight=138.016}}
{{#set: inchi-key=inchikey=nvowzibkqiwtdg-aducosnasa-j}}
+
{{#set: inchi-key=inchikey=lipounrjvlnbcd-uhfffaoysa-l}}

Latest revision as of 19:36, 17 March 2021

Metabolite ACETYL-P

  • common-name:
    • acetyl phosphate
  • molecular-weight:
    • 138.016
  • inchi-key:
    • lipounrjvlnbcd-uhfffaoysa-l
  • smiles:
    • cc(op([o-])(=o)[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality